CAS 142992-72-1 appears in our catalog under these names: 1–(4–Nitrophenyl)guanidine nitrate, 1-(4-Nitrophenyl)guanidine nitrate, 97%. Offered by: GLPBio, AmBeed. Available pack sizes: 1g, 5g.
Nitric acid;2-(4-nitrophenyl)guanidine (CAS 142992-72-1) is a chemical compound with the molecular formula C7H9N5O5 and a molecular weight of 243.18 g/mol. IUPAC name: nitric acid;2-(4-nitrophenyl)guanidine. InChIKey: REOYYGKJQOLCPZ-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O5 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | nitric acid;2-(4-nitrophenyl)guanidine |
| InChIKey | REOYYGKJQOLCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)N)[N+](=O)[O-].[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)