CAS 142992-99-2 appears in our catalog under these names: 3-Nitrophenylguanidine nitrate, 95%, 3-Nitrophenylguanidine Nitrate. Offered by: Combi-blocks, TRC. Available pack sizes: 100mg, 1g, 2,5g, 250mg.
Nitric acid;2-(3-nitrophenyl)guanidine (CAS 142992-99-2) is a chemical compound with the molecular formula C7H9N5O5 and a molecular weight of 243.18 g/mol. IUPAC name: nitric acid;2-(3-nitrophenyl)guanidine. InChIKey: VBYYPCNNGNGURO-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O5 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | nitric acid;2-(3-nitrophenyl)guanidine |
| InChIKey | VBYYPCNNGNGURO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)