Products 1430328-80-5
CAS 1430328-80-5 is the registry number for 3,5-Bis((1H-imidazol-1-yl)methyl)benzoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-bis(imidazol-1-ylmethyl)benzoic acid;hydrochloride (CAS 1430328-80-5) is a chemical compound with the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. IUPAC name: 3,5-bis(imidazol-1-ylmethyl)benzoic acid;hydrochloride. InChIKey: OFKVAGCRCQCULR-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN4O2 |
|---|---|
| Molecular weight | 318.76 g/mol |
| IUPAC name | 3,5-bis(imidazol-1-ylmethyl)benzoic acid;hydrochloride |
| InChIKey | OFKVAGCRCQCULR-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CC2=CC(=CC(=C2)C(=O)O)CN3C=CN=C3.Cl |
Computed by PubChem (NCBI)