CAS 1609980-39-3 appears in our catalog under these names: STS-E412, 98%, STS-E412/ 99.01% (existing batch purity), STS–E412, STS-E412 98%, STS-E412, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
2-[2-(4-chlorophenoxy)ethoxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 1609980-39-3) is a chemical compound with the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. IUPAC name: 2-[2-(4-chlorophenoxy)ethoxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: XQFMOBKQELKMKF-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN4O2 |
|---|---|
| Molecular weight | 318.76 g/mol |
| IUPAC name | 2-[2-(4-chlorophenoxy)ethoxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | XQFMOBKQELKMKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)OCCOC3=CC=C(C=C3)Cl)C |
Computed by PubChem (NCBI)