CAS 143112-52-1 appears in our catalog under these names: (S)-(+)-Nbd-apy, 95%, (S)–(+)–4–(3–Amino–pyrrolidino)–7–nitrobenzofurazan, (S)-(+)-NBD-APy [=(S)-(+)-4-Nitro-7-(3-aminopyrrolidin-1-yl)-2,1,3-benzoxadiazole] [HPLC Labeling Reagent for e.e. Determination], (S)-(+)-NBD-APy, (S)-(+)-NBD-APy, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10mg.
(3S)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidin-3-amine (CAS 143112-52-1) is a chemical compound with the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. IUPAC name: (3S)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidin-3-amine. InChIKey: QSDDQXROWUJAJX-LURJTMIESA-N.
| Molecular formula | C10H11N5O3 |
|---|---|
| Molecular weight | 249.23 g/mol |
| IUPAC name | (3S)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidin-3-amine |
| InChIKey | QSDDQXROWUJAJX-LURJTMIESA-N |
| SMILES | C1CN(C[C@H]1N)C2=CC=C(C3=NON=C23)[N+](=O)[O-] |
Computed by PubChem (NCBI)