Products 20535-04-0
CAS 20535-04-0 is the registry number for 4′,5′-Didehydro-5′-deoxyadenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-aminopurin-9-yl)-5-methylideneoxolane-3,4-diol (CAS 20535-04-0) is a chemical compound with the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. IUPAC name: 2-(6-aminopurin-9-yl)-5-methylideneoxolane-3,4-diol. InChIKey: OGHMFWYXBZGWRH-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O3 |
|---|---|
| Molecular weight | 249.23 g/mol |
| IUPAC name | 2-(6-aminopurin-9-yl)-5-methylideneoxolane-3,4-diol |
| InChIKey | OGHMFWYXBZGWRH-UHFFFAOYSA-N |
| SMILES | C=C1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O |
Computed by PubChem (NCBI)