Products 1431166-12-9
CAS 1431166-12-9 is the registry number for FL442. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-3-yl)-2-(trifluoromethyl)benzonitrile (CAS 1431166-12-9) is a chemical compound with the molecular formula C15H13F3N2O and a molecular weight of 294.27 g/mol. IUPAC name: 4-(3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-3-yl)-2-(trifluoromethyl)benzonitrile. InChIKey: KWOXBSUGDNAEGP-UHFFFAOYSA-N.
| Molecular formula | C15H13F3N2O |
|---|---|
| Molecular weight | 294.27 g/mol |
| IUPAC name | 4-(3a,4,5,6,7,7a-hexahydro-1,2-benzoxazol-3-yl)-2-(trifluoromethyl)benzonitrile |
| InChIKey | KWOXBSUGDNAEGP-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C(=NO2)C3=CC(=C(C=C3)C#N)C(F)(F)F |
Computed by PubChem (NCBI)