CAS 2270912-24-6 is the registry number for 3-Amino-n-benzyl-4-trifluoromethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-amino-N-benzyl-4-(trifluoromethyl)benzamide (CAS 2270912-24-6) is a chemical compound with the molecular formula C15H13F3N2O and a molecular weight of 294.27 g/mol. IUPAC name: 3-amino-N-benzyl-4-(trifluoromethyl)benzamide. InChIKey: DMUAVVHSSJFVAL-UHFFFAOYSA-N.
| Molecular formula | C15H13F3N2O |
|---|---|
| Molecular weight | 294.27 g/mol |
| IUPAC name | 3-amino-N-benzyl-4-(trifluoromethyl)benzamide |
| InChIKey | DMUAVVHSSJFVAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)