CAS 14312-89-1 appears in our catalog under these names: Methyl perfluoroheptanoate, 95%, Methyl Tridecafluoroheptanoate, Methyl Tridecafluoroheptanoate, >96.0%(GC), Methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate, 96%(GC),RG, 96%(GC),RG, Methyl perfluoroheptanoate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate (CAS 14312-89-1) is a chemical compound with the molecular formula C8H3F13O2 and a molecular weight of 378.09 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate. InChIKey: JHROQORAJUWVCD-UHFFFAOYSA-N.
| Molecular formula | C8H3F13O2 |
|---|---|
| Molecular weight | 378.09 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoate |
| InChIKey | JHROQORAJUWVCD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)