CAS 872398-75-9 is the registry number for 2-Perfluorohexyl-(1,2-13C2)-Ethanoic Acid. Offered by: TRC. Available pack sizes: 25mg.
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octanoic acid (CAS 872398-75-9) is a chemical compound with the molecular formula C8H3F13O2 and a molecular weight of 380.07 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octanoic acid. InChIKey: LRWIIEJPCFNNCZ-ZDOIIHCHSA-N.
| Molecular formula | C8H3F13O2 |
|---|---|
| Molecular weight | 380.07 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro(1,2-13C2)octanoic acid |
| InChIKey | LRWIIEJPCFNNCZ-ZDOIIHCHSA-N |
| SMILES | [13CH2]([13C](=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)