CAS 1431330-20-9 is the registry number for 2-Bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1431330-20-9) is a chemical compound with the molecular formula C12H16BBrO3 and a molecular weight of 298.97 g/mol. IUPAC name: 2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: QPSUEFOXBHBNGK-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO3 |
|---|---|
| Molecular weight | 298.97 g/mol |
| IUPAC name | 2-bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | QPSUEFOXBHBNGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Br)O |
Computed by PubChem (NCBI)