Products 2370026-67-6
CAS 2370026-67-6 is the registry number for 2-bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2370026-67-6) is a chemical compound with the molecular formula C12H16BBrO3 and a molecular weight of 298.97 g/mol. IUPAC name: 2-bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: GTOCGUJYNAWCHI-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO3 |
|---|---|
| Molecular weight | 298.97 g/mol |
| IUPAC name | 2-bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | GTOCGUJYNAWCHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)Br |
Computed by PubChem (NCBI)