CAS 1218789-50-4 appears in our catalog under these names: 3-Bromo-5-hydroxyphenylboronic acid, pinacol ester, 96%, 3-Bromo-5-hydroxyphenylboronic acid, 95%, 95%, 3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1218789-50-4) is a chemical compound with the molecular formula C12H16BBrO3 and a molecular weight of 298.97 g/mol. IUPAC name: 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: SZNZHUSGGFDSIP-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO3 |
|---|---|
| Molecular weight | 298.97 g/mol |
| IUPAC name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | SZNZHUSGGFDSIP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)O |
Computed by PubChem (NCBI)