CAS 1431332-65-8 is the registry number for (R)-2-(3,4-Dichlorophenyl)-4,4-dimethylpyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3,4-dichlorophenyl)-4,4-dimethylpyrrolidine (CAS 1431332-65-8) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: (2R)-2-(3,4-dichlorophenyl)-4,4-dimethylpyrrolidine. InChIKey: DBYSFPKQYNCRMO-LLVKDONJSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | (2R)-2-(3,4-dichlorophenyl)-4,4-dimethylpyrrolidine |
| InChIKey | DBYSFPKQYNCRMO-LLVKDONJSA-N |
| SMILES | CC1(C[C@@H](NC1)C2=CC(=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)