Products 557799-32-3
CAS 557799-32-3 is the registry number for N-[(3,4-Dichlorophenyl)methyl]cyclopentanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(3,4-dichlorophenyl)methyl]cyclopentanamine (CAS 557799-32-3) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: N-[(3,4-dichlorophenyl)methyl]cyclopentanamine. InChIKey: QBEWAWCVBHNCPZ-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | N-[(3,4-dichlorophenyl)methyl]cyclopentanamine |
| InChIKey | QBEWAWCVBHNCPZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)