Products 1431362-93-4
CAS 1431362-93-4 is the registry number for DPQZ. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(dimethylamino)-2-naphthalen-1-yl-3H-quinazolin-4-one (CAS 1431362-93-4) is a chemical compound with the molecular formula C20H17N3O and a molecular weight of 315.4 g/mol. IUPAC name: 6-(dimethylamino)-2-naphthalen-1-yl-3H-quinazolin-4-one. InChIKey: SKVCPKXUVLJUEL-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 6-(dimethylamino)-2-naphthalen-1-yl-3H-quinazolin-4-one |
| InChIKey | SKVCPKXUVLJUEL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)N=C(NC2=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)