Products 1431377-51-3
CAS 1431377-51-3 is the registry number for Methyl 4'-methylbiphenyl-2-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9,9-dimethyl-10H-anthracene-2,7-diol (CAS 1431377-51-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 9,9-dimethyl-10H-anthracene-2,7-diol. InChIKey: JOJHCBYBUWBBSI-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 9,9-dimethyl-10H-anthracene-2,7-diol |
| InChIKey | JOJHCBYBUWBBSI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CC3=C1C=C(C=C3)O)C=CC(=C2)O)C |
Computed by PubChem (NCBI)