CAS 1431473-04-9 is the registry number for (2R,5R)-Benzyl 5-hydroxy-2-methylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R,5R)-5-hydroxy-2-methylpiperidine-1-carboxylate (CAS 1431473-04-9) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl (2R,5R)-5-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: PORAIKBIDRNMQN-DGCLKSJQSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl (2R,5R)-5-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | PORAIKBIDRNMQN-DGCLKSJQSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)