CAS 1431509-30-6 appears in our catalog under these names: 2-(2-Bromo-2-methylpropionyloxy)-2-methylpropionic acid, 95%, 2–(2–Bromo–2–methylpropionyloxy)–2–methylpropionic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
2-(2-bromo-2-methylpropanoyl)oxy-2-methylpropanoic acid (CAS 1431509-30-6) is a chemical compound with the molecular formula C8H13BrO4 and a molecular weight of 253.09 g/mol. IUPAC name: 2-(2-bromo-2-methylpropanoyl)oxy-2-methylpropanoic acid. InChIKey: HINBZZBSDKUDPC-UHFFFAOYSA-N.
| Molecular formula | C8H13BrO4 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-(2-bromo-2-methylpropanoyl)oxy-2-methylpropanoic acid |
| InChIKey | HINBZZBSDKUDPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC(=O)C(C)(C)Br |
Computed by PubChem (NCBI)