CAS 914224-26-3 appears in our catalog under these names: 2-Bromo-4-(tert-butoxy)-4-oxobutanoic acid, 95%, 2-Bromo-4-(tert-butoxy)-4-oxobutanoic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 500mg, 2.5g.
2-bromo-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 914224-26-3) is a chemical compound with the molecular formula C8H13BrO4 and a molecular weight of 253.09 g/mol. IUPAC name: 2-bromo-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: DRYUSTNSODJZDB-UHFFFAOYSA-N.
| Molecular formula | C8H13BrO4 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 2-bromo-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | DRYUSTNSODJZDB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)O)Br |
Computed by PubChem (NCBI)