CAS 1431641-29-0 appears in our catalog under these names: (+/–)–ADX 71743, (±)-ADX 71743, ADX71743, ≥98%, ≥98%, ADX71743, 99.30%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 100mg, 5mg, 1 mg, 5 mg.
6-(2,4-dimethylphenyl)-2-ethyl-6,7-dihydro-5H-1,3-benzoxazol-4-one (CAS 1431641-29-0) is a chemical compound with the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. IUPAC name: 6-(2,4-dimethylphenyl)-2-ethyl-6,7-dihydro-5H-1,3-benzoxazol-4-one. InChIKey: CPKZCQHJDFSOJT-UHFFFAOYSA-N.
| Molecular formula | C17H19NO2 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 6-(2,4-dimethylphenyl)-2-ethyl-6,7-dihydro-5H-1,3-benzoxazol-4-one |
| InChIKey | CPKZCQHJDFSOJT-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(O1)CC(CC2=O)C3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)