Products 1431724-30-9
CAS 1431724-30-9 appears in our catalog under these names: Propargyl caffeamide, PACA. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, Get quote.
(E)-3-(3,4-dihydroxyphenyl)-N-prop-2-ynylprop-2-enamide (CAS 1431724-30-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)-N-prop-2-ynylprop-2-enamide. InChIKey: HLHSUNWAPXINQU-GQCTYLIASA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)-N-prop-2-ynylprop-2-enamide |
| InChIKey | HLHSUNWAPXINQU-GQCTYLIASA-N |
| SMILES | C#CCNC(=O)/C=C/C1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)