Products 1431841-88-1

CAS 1431841-88-1 is the registry number for Ethyl 2,2-difluoro-2-(4-oxochromen-3-yl)acetate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-(4-oxochromen-3-yl)acetate (CAS 1431841-88-1) is a chemical compound with the molecular formula C13H10F2O4 and a molecular weight of 268.21 g/mol. IUPAC name: ethyl 2,2-difluoro-2-(4-oxochromen-3-yl)acetate. InChIKey: SULNZXRIXUHHLS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10F2O4
Molecular weight268.21 g/mol
IUPAC nameethyl 2,2-difluoro-2-(4-oxochromen-3-yl)acetate
InChIKeySULNZXRIXUHHLS-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=COC2=CC=CC=C2C1=O)(F)F

Computed by PubChem (NCBI)