Products 438220-32-7

CAS 438220-32-7 is the registry number for 5-(2,4-Difluoro-phenoxymethyl)-furan-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate (CAS 438220-32-7) is a chemical compound with the molecular formula C13H10F2O4 and a molecular weight of 268.21 g/mol. IUPAC name: methyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate. InChIKey: IPYDJIIRBUKCCV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10F2O4
Molecular weight268.21 g/mol
IUPAC namemethyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate
InChIKeyIPYDJIIRBUKCCV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)COC2=C(C=C(C=C2)F)F

Computed by PubChem (NCBI)