CAS 438220-32-7 is the registry number for 5-(2,4-Difluoro-phenoxymethyl)-furan-2-carboxylic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate (CAS 438220-32-7) is a chemical compound with the molecular formula C13H10F2O4 and a molecular weight of 268.21 g/mol. IUPAC name: methyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate. InChIKey: IPYDJIIRBUKCCV-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O4 |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | methyl 5-[(2,4-difluorophenoxy)methyl]furan-2-carboxylate |
| InChIKey | IPYDJIIRBUKCCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(O1)COC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)