CAS 1431868-21-1 is the registry number for Sodium 4-chloro-3-methylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Sodium 4-chloro-3-methylbenzoate (CAS 1431868-21-1) is a chemical compound with the molecular formula C8H6ClNaO2 and a molecular weight of 192.57 g/mol. IUPAC name: sodium 4-chloro-3-methylbenzoate. InChIKey: ZWGVPZAIZPUICI-UHFFFAOYSA-M.
| Molecular formula | C8H6ClNaO2 |
|---|---|
| Molecular weight | 192.57 g/mol |
| IUPAC name | sodium 4-chloro-3-methylbenzoate |
| InChIKey | ZWGVPZAIZPUICI-UHFFFAOYSA-M |
| SMILES | CC1=C(C=CC(=C1)C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)