CAS 1708942-15-7 is the registry number for Sodium 3-chloro-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Sodium 3-chloro-4-methylbenzoate (CAS 1708942-15-7) is a chemical compound with the molecular formula C8H6ClNaO2 and a molecular weight of 192.57 g/mol. IUPAC name: sodium 3-chloro-4-methylbenzoate. InChIKey: BEMRQBJGDQQBOE-UHFFFAOYSA-M.
| Molecular formula | C8H6ClNaO2 |
|---|---|
| Molecular weight | 192.57 g/mol |
| IUPAC name | sodium 3-chloro-4-methylbenzoate |
| InChIKey | BEMRQBJGDQQBOE-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1)C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)