CAS 1431868-60-8 appears in our catalog under these names: N6-Boc-1,6-Diazaspiro(3.3)heptane Semi Oxalate, tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate hemioxalate, 97%, 97%, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate oxalate(2:1), 95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
Bis(tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate);oxalic acid (CAS 1431868-60-8) is a chemical compound with the molecular formula C22H38N4O8 and a molecular weight of 486.6 g/mol. IUPAC name: bis(tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate);oxalic acid. InChIKey: MGTPGQCATJIULY-UHFFFAOYSA-N.
| Molecular formula | C22H38N4O8 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | bis(tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate);oxalic acid |
| InChIKey | MGTPGQCATJIULY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN2.CC(C)(C)OC(=O)N1CC2(C1)CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)