Products 1523571-10-9

CAS 1523571-10-9 is the registry number for tert-Butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate oxalate(2:1), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 50g.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate);oxalic acid (CAS 1523571-10-9) is a chemical compound with the molecular formula C22H38N4O8 and a molecular weight of 486.6 g/mol. IUPAC name: bis(tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate);oxalic acid. InChIKey: JVDMWTHLVBUYPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H38N4O8
Molecular weight486.6 g/mol
IUPAC namebis(tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate);oxalic acid
InChIKeyJVDMWTHLVBUYPQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC12CNC2.CC(C)(C)OC(=O)N1CCC12CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)