Products 1431962-31-0
CAS 1431962-31-0 is the registry number for 1-Methyl-3-(2,2,2-trifluoroethoxy)-1H-pyrazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-3-(2,2,2-trifluoroethoxy)pyrazol-4-amine;hydrochloride (CAS 1431962-31-0) is a chemical compound with the molecular formula C6H9ClF3N3O and a molecular weight of 231.60 g/mol. IUPAC name: 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazol-4-amine;hydrochloride. InChIKey: ATBIZMFFJITDQA-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3O |
|---|---|
| Molecular weight | 231.60 g/mol |
| IUPAC name | 1-methyl-3-(2,2,2-trifluoroethoxy)pyrazol-4-amine;hydrochloride |
| InChIKey | ATBIZMFFJITDQA-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)