CAS 1909319-53-4 is the registry number for 3-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)propan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propan-1-amine;hydrochloride (CAS 1909319-53-4) is a chemical compound with the molecular formula C6H9ClF3N3O and a molecular weight of 231.60 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propan-1-amine;hydrochloride. InChIKey: UDCNFHZBDNCNQQ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3N3O |
|---|---|
| Molecular weight | 231.60 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]propan-1-amine;hydrochloride |
| InChIKey | UDCNFHZBDNCNQQ-UHFFFAOYSA-N |
| SMILES | C(CC1=NOC(=N1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)