Products 1431968-02-3

CAS 1431968-02-3 is the registry number for 1-(4-Aminophenyl)-1H-pyrazole-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

1-(4-aminophenyl)pyrazole-3-carboxylic acid;hydrochloride (CAS 1431968-02-3) is a chemical compound with the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. IUPAC name: 1-(4-aminophenyl)pyrazole-3-carboxylic acid;hydrochloride. InChIKey: VGGLUCUFABSMRB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClN3O2
Molecular weight239.66 g/mol
IUPAC name1-(4-aminophenyl)pyrazole-3-carboxylic acid;hydrochloride
InChIKeyVGGLUCUFABSMRB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N)N2C=CC(=N2)C(=O)O.Cl

Computed by PubChem (NCBI)