Products 1432053-94-5
CAS 1432053-94-5 is the registry number for Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate (CAS 1432053-94-5) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate. InChIKey: DMZCUMSFWKUUCE-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | ethyl 5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | DMZCUMSFWKUUCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)