Products 1484783-19-8
CAS 1484783-19-8 is the registry number for 1-(3-Methoxyphenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 25mg.
1-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 1484783-19-8) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: 1-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: YKJXLEWKCIDDPH-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | YKJXLEWKCIDDPH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=CC(=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)