Products 1432060-12-2
CAS 1432060-12-2 appears in our catalog under these names: N-Methyl-o-phenylenediamine-d3, Dihydrochloride, N-Methyl-o-phenylenediamine-d3 Dihydrochloride. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-N-(trideuteriomethyl)benzene-1,2-diamine;dihydrochloride (CAS 1432060-12-2) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 198.10 g/mol. IUPAC name: 2-N-(trideuteriomethyl)benzene-1,2-diamine;dihydrochloride. InChIKey: DKEONVNYXODZRQ-GXXYEPOPSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 198.10 g/mol |
| IUPAC name | 2-N-(trideuteriomethyl)benzene-1,2-diamine;dihydrochloride |
| InChIKey | DKEONVNYXODZRQ-GXXYEPOPSA-N |
| SMILES | [2H]C([2H])([2H])NC1=CC=CC=C1N.Cl.Cl |
Computed by PubChem (NCBI)