Products 1432060-33-7
CAS 1432060-33-7 is the registry number for 3-{1-((tert-Butoxy)carbonyl)piperidin-4-yl}-1H-indole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indole-5-carboxylic acid (CAS 1432060-33-7) is a chemical compound with the molecular formula C19H24N2O4 and a molecular weight of 344.4 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indole-5-carboxylic acid. InChIKey: JUVUQAKNOFBBBO-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indole-5-carboxylic acid |
| InChIKey | JUVUQAKNOFBBBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CNC3=C2C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)