Products 1432061-73-8
CAS 1432061-73-8 appears in our catalog under these names: Gabapentin-d6 HCl, Gabapentin-d6 Hydrochloride, >95% (HPLC), Gabapentin-d6 hydrochloride, Gabapentin-d6 (hydrochloride). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 0,5mg, 10mg, 1mg, 5mg, 50mg, 25mg, 1 mg.
2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid;hydrochloride (CAS 1432061-73-8) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 213.73 g/mol. IUPAC name: 2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid;hydrochloride. InChIKey: XBUDZAQEMFGLEU-LRDWTYOMSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 213.73 g/mol |
| IUPAC name | 2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid;hydrochloride |
| InChIKey | XBUDZAQEMFGLEU-LRDWTYOMSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])[2H])([2H])[2H])(CC(=O)O)CN)[2H].Cl |
Computed by PubChem (NCBI)