Products 1432062-24-2

CAS 1432062-24-2 is the registry number for 4-(4-Amino-phenylsulfanylmethyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate (CAS 1432062-24-2) is a chemical compound with the molecular formula C17H26N2O2S and a molecular weight of 322.5 g/mol. IUPAC name: tert-butyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate. InChIKey: ZBNHBBLTEHQBNR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26N2O2S
Molecular weight322.5 g/mol
IUPAC nametert-butyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate
InChIKeyZBNHBBLTEHQBNR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CSC2=CC=C(C=C2)N

Computed by PubChem (NCBI)