CAS 41780-53-4 appears in our catalog under these names: N'–(4–(tert–Butyl)cyclohexylidene)–4–methylbenzenesulfonohydrazide, N'-(4-tert-Butylcyclohexylidene)-4-methylbenzenesulfonohydrazide, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
N-[(4-tert-butylcyclohexylidene)amino]-4-methylbenzenesulfonamide (CAS 41780-53-4) is a chemical compound with the molecular formula C17H26N2O2S and a molecular weight of 322.5 g/mol. IUPAC name: N-[(4-tert-butylcyclohexylidene)amino]-4-methylbenzenesulfonamide. InChIKey: QHURMYMCJYDFKY-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O2S |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | N-[(4-tert-butylcyclohexylidene)amino]-4-methylbenzenesulfonamide |
| InChIKey | QHURMYMCJYDFKY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN=C2CCC(CC2)C(C)(C)C |
Computed by PubChem (NCBI)