CAS 1432075-29-0 is the registry number for 2,2,4,7-Tetramethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,4,7-tetramethyl-4-phenyl-1,3-dihydroquinoline (CAS 1432075-29-0) is a chemical compound with the molecular formula C19H23N and a molecular weight of 265.4 g/mol. IUPAC name: 2,2,4,7-tetramethyl-4-phenyl-1,3-dihydroquinoline. InChIKey: BASNDVJBHXVYOJ-UHFFFAOYSA-N.
| Molecular formula | C19H23N |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 2,2,4,7-tetramethyl-4-phenyl-1,3-dihydroquinoline |
| InChIKey | BASNDVJBHXVYOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CC(N2)(C)C)(C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)