CAS 878973-23-0 appears in our catalog under these names: 2,2,4,6-Tetramethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 95%, 2,2,4,6-Tetramethyl-4-phenyl-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,2,4,6-tetramethyl-4-phenyl-1,3-dihydroquinoline (CAS 878973-23-0) is a chemical compound with the molecular formula C19H23N and a molecular weight of 265.4 g/mol. IUPAC name: 2,2,4,6-tetramethyl-4-phenyl-1,3-dihydroquinoline. InChIKey: RHGWAUGRQYSLSX-UHFFFAOYSA-N.
| Molecular formula | C19H23N |
|---|---|
| Molecular weight | 265.4 g/mol |
| IUPAC name | 2,2,4,6-tetramethyl-4-phenyl-1,3-dihydroquinoline |
| InChIKey | RHGWAUGRQYSLSX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(CC2(C)C3=CC=CC=C3)(C)C |
Computed by PubChem (NCBI)