Products 1432130-38-5
CAS 1432130-38-5 is the registry number for 2-methyl-1-(4-methylpiperazin-1-yl)-2-(4-nitrophenyl)propan-1-one. Offered by: Chemat. Available pack sizes: 1g.
2-methyl-1-(4-methylpiperazin-1-yl)-2-(4-nitrophenyl)propan-1-one (CAS 1432130-38-5) is a chemical compound with the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. IUPAC name: 2-methyl-1-(4-methylpiperazin-1-yl)-2-(4-nitrophenyl)propan-1-one. InChIKey: CAEUGAAFIWDZJX-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O3 |
|---|---|
| Molecular weight | 291.35 g/mol |
| IUPAC name | 2-methyl-1-(4-methylpiperazin-1-yl)-2-(4-nitrophenyl)propan-1-one |
| InChIKey | CAEUGAAFIWDZJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)N2CCN(CC2)C |
Computed by PubChem (NCBI)