CAS 143225-31-4 appears in our catalog under these names: Fosamprenavir Impurity 4, Fosamprenavir Impurity 6, 1,1-Dimethylethyl Ester ((1S,2S)-2-Hydroxy-3-((2-methylpropyl)amino)-1-(phenylmethyl)propyl)carbamic Acid, 1,1-Dimethylethyl Ester ((1S,2S)-2-Hydroxy-3-((2-methylpropyl)amino)-1-(phenylmethyl)propyl)carbamic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
Tert-butyl N-[(2S,3S)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate (CAS 143225-31-4) is a chemical compound with the molecular formula C19H32N2O3 and a molecular weight of 336.5 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate. InChIKey: NVEPLQDORJSXRO-IRXDYDNUSA-N.
| Molecular formula | C19H32N2O3 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate |
| InChIKey | NVEPLQDORJSXRO-IRXDYDNUSA-N |
| SMILES | CC(C)CNC[C@@H]([C@H](CC1=CC=CC=C1)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)