CAS 853904-81-1 appears in our catalog under these names: Fosamprenavir Impurity 2, Fosamprenavir Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Tert-butyl N-[(2R,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate (CAS 853904-81-1) is a chemical compound with the molecular formula C19H32N2O3 and a molecular weight of 336.5 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate. InChIKey: NVEPLQDORJSXRO-IAGOWNOFSA-N.
| Molecular formula | C19H32N2O3 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-3-hydroxy-4-(2-methylpropylamino)-1-phenylbutan-2-yl]carbamate |
| InChIKey | NVEPLQDORJSXRO-IAGOWNOFSA-N |
| SMILES | CC(C)CNC[C@H]([C@@H](CC1=CC=CC=C1)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)