Products 143246-41-7
CAS 143246-41-7 is the registry number for Microstegiol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(1S)-1-hydroxy-8,13,13-trimethyl-3-propan-2-yltricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one (CAS 143246-41-7) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: (1S)-1-hydroxy-8,13,13-trimethyl-3-propan-2-yltricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one. InChIKey: KIXMQGXACFNMEM-FQEVSTJZSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (1S)-1-hydroxy-8,13,13-trimethyl-3-propan-2-yltricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
| InChIKey | KIXMQGXACFNMEM-FQEVSTJZSA-N |
| SMILES | CC1=C2CCCC([C@@]3(C2=C(C=C1)C=C(C3=O)C(C)C)O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
microstegiol, orb1990990