CAS 1432680-11-9 is the registry number for 6-(2,2,2-Trifluoroethoxy)pyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2,2,2-trifluoroethoxy)pyridine-3-sulfonyl chloride (CAS 1432680-11-9) is a chemical compound with the molecular formula C7H5ClF3NO3S and a molecular weight of 275.63 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)pyridine-3-sulfonyl chloride. InChIKey: QEDNFZJYFXUQDH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO3S |
|---|---|
| Molecular weight | 275.63 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)pyridine-3-sulfonyl chloride |
| InChIKey | QEDNFZJYFXUQDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)