CAS 219715-41-0 is the registry number for 3-(Chlorosulfonyl) Des-N-(5,7-Dimethoxy(1,2,4)triazolo(1,5-a)pyrimidin-2-yl) Pyroxsulam. Offered by: TRC. Available pack sizes: 500mg.
2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonyl chloride (CAS 219715-41-0) is a chemical compound with the molecular formula C7H5ClF3NO3S and a molecular weight of 275.63 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonyl chloride. InChIKey: DMKFWTCEKLNOKK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO3S |
|---|---|
| Molecular weight | 275.63 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| InChIKey | DMKFWTCEKLNOKK-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC(=C1S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)