CAS 1432680-97-1 appears in our catalog under these names: 3,3,4,4,5,5-Hexafluoropiperidine hydrochloride, 97%, 3,3,4,4,5,5-Hexafluoropiperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
3,3,4,4,5,5-hexafluoropiperidine;hydrochloride (CAS 1432680-97-1) is a chemical compound with the molecular formula C5H6ClF6N and a molecular weight of 229.55 g/mol. IUPAC name: 3,3,4,4,5,5-hexafluoropiperidine;hydrochloride. InChIKey: NUXVFJQCWISILA-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF6N |
|---|---|
| Molecular weight | 229.55 g/mol |
| IUPAC name | 3,3,4,4,5,5-hexafluoropiperidine;hydrochloride |
| InChIKey | NUXVFJQCWISILA-UHFFFAOYSA-N |
| SMILES | C1C(C(C(CN1)(F)F)(F)F)(F)F.Cl |
Computed by PubChem (NCBI)