CAS 2228364-54-1 is the registry number for 2,3-Bis(trifluoromethyl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-bis(trifluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 2228364-54-1) is a chemical compound with the molecular formula C5H6ClF6N and a molecular weight of 229.55 g/mol. IUPAC name: 2,3-bis(trifluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: FGTSFUBDJSWKIT-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF6N |
|---|---|
| Molecular weight | 229.55 g/mol |
| IUPAC name | 2,3-bis(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | FGTSFUBDJSWKIT-UHFFFAOYSA-N |
| SMILES | C1(C(C1N)C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)