Products 1432681-16-7

CAS 1432681-16-7 appears in our catalog under these names: 2-Cyano-2,2-dimethylethane-1-sulfonyl chloride, 95%, 2-Cyano-2,2-dimethylethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-cyano-2-methylpropane-1-sulfonyl chloride (CAS 1432681-16-7) is a chemical compound with the molecular formula C5H8ClNO2S and a molecular weight of 181.64 g/mol. IUPAC name: 2-cyano-2-methylpropane-1-sulfonyl chloride. InChIKey: DOPCRGLDAAXZDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClNO2S
Molecular weight181.64 g/mol
IUPAC name2-cyano-2-methylpropane-1-sulfonyl chloride
InChIKeyDOPCRGLDAAXZDQ-UHFFFAOYSA-N
SMILESCC(C)(CS(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)