Products 35517-25-0

CAS 35517-25-0 appears in our catalog under these names: 4-Cyanobutane-1-sulfonyl chloride, 95%, 4-Cyanobutane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

4-cyanobutane-1-sulfonyl chloride (CAS 35517-25-0) is a chemical compound with the molecular formula C5H8ClNO2S and a molecular weight of 181.64 g/mol. IUPAC name: 4-cyanobutane-1-sulfonyl chloride. InChIKey: DRTLCNOBWNMKHN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClNO2S
Molecular weight181.64 g/mol
IUPAC name4-cyanobutane-1-sulfonyl chloride
InChIKeyDRTLCNOBWNMKHN-UHFFFAOYSA-N
SMILESC(CCS(=O)(=O)Cl)CC#N

Computed by PubChem (NCBI)